N-(4-methoxyphenyl)-4-methylbenzamide
N-(4-methoxyphenyl)-4-methylbenzamide
Also Known As: N-(4-methoxyphenyl)-4-methylbenzamide|N-(4-Methoxy-phenyl)-4-methyl-benzamide|Oprea1_523542|Oprea1_689688|4-methyl-benzoic acid p-anisidide|N-p-methoxyphenyl-p-methylbenzamide|Benzamide, N-(4-methoxyphenyl)-4-methyl-|4-Methyl-N-(4-methoxyphenyl)benzamide|N-(4-methoxyphenyl)-4-methyl-benzamide|N-(4-methoxyphenyl)(4-methylphenyl)carboxamide|N-(4-Methoxyphenyl)-4-methylbenzenecarboxamide|AF-960/00464033|SR-01000414955-1
| Molecular Formula | C15H15NO2 |
|---|---|
| Molecular Weight | 241.11028 g/mol |
| LogP | 3.0 |
| Topological Polar Surface Area | 38.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 241.11028 |
| Monoisotopic Mass | 241.11028 |
| Heavy Atoms | 18 |
| Complexity | 264.0 |
Chemical Identifiers
| CAS Number | 33667-91-3 |
|---|---|
| SMILES | CC1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)OC |
| InChIKey | ZVMFHSKXFRTBIG-UHFFFAOYSA-N |
Product Overview
N-(4-methoxyphenyl)-4-methylbenzamide (CAS 33667-91-3), with molecular formula C15H15NO2 and molecular weight 241.11028 g/mol. IUPAC: N-(4-methoxyphenyl)-4-methylbenzamide.
N-(4-methoxyphenyl)-4-methylbenzamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »