3,4-Dihydro-1H-[1]benzofuro[3,2-b]azepine-2,5-dione
3,4-dihydro-1H-[1]benzofuro[3,2-b]azepine-2,5-dione
Also Known As: Oprea1_513497|Oprea1_612971|BAS 03276980|3,4-Dihydro-1H-[1]benzofuro[3,2-b]azepine-2,5-dione|7,8-Dihydro-5H-10-oxa-5-aza-benzo[a]azulene-6,9-dione|AG-205/36915090|1H,3H,4H-azepino[6,7-b]benzo[d]furan-2,5-dione|SR-01000481480-1|3,4-dihydro-1H-benzofuro[3,2-b]azepine-2,5-dione|3,4-Dihydro-1H-[1]benzofuro[3,2-b]azepine-2,5-dione #|A1660/0070744
| Molecular Formula | C12H9NO3 |
|---|---|
| Molecular Weight | 215.05824 g/mol |
| LogP | 1.3 |
| Topological Polar Surface Area | 59.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 0 |
| Exact Mass | 215.05824 |
| Monoisotopic Mass | 215.05824 |
| Heavy Atoms | 16 |
| Complexity | 328.0 |
Chemical Identifiers
| CAS Number | 337471-01-9 |
|---|---|
| SMILES | C1CC(=O)NC2=C(C1=O)OC3=CC=CC=C32 |
| InChIKey | YXYAMNCREGTQOU-UHFFFAOYSA-N |
Product Overview
3,4-Dihydro-1H-[1]benzofuro[3,2-b]azepine-2,5-dione (CAS 337471-01-9), with molecular formula C12H9NO3 and molecular weight 215.05824 g/mol. IUPAC: 3,4-dihydro-1H-[1]benzofuro[3,2-b]azepine-2,5-dione.
3,4-Dihydro-1H-[1]benzofuro[3,2-b]azepine-2,5-dione is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »