(3,4-Dichlorophenyl)-(4-phenylpiperazin-1-yl)methanone
(3,4-dichlorophenyl)-(4-phenylpiperazin-1-yl)methanone
Also Known As: piperazine, a17|CBMicro_024828|Oprea1_773159|Oprea1_850016|BAS 00541361|1-(3,4-dichlorobenzoyl)-4-phenylpiperazine|BIM-0024896.P001|(3,4-dichlorophenyl)-(4-phenylpiperazin-1-yl)methanone|3,4-dichlorophenyl 4-phenylpiperazinyl ketone|1-[(3,4-dichlorophenyl)carbonyl]-4-phenylpiperazine|AB00089553-01|SR-01000478321-1|(3,4-dichlorophenyl)(4-phenylpiperazin-1-yl)methanone|(3,4-Dichloro-phenyl)-(4-phenyl-piperazin-1-yl)-methanone|(3,4-DICHLOROPHENYL)(4-PHENYLPIPERAZINO)METHANONE
| Molecular Formula | C17H16Cl2N2O |
|---|---|
| Molecular Weight | 334.06396 g/mol |
| LogP | 4.2 |
| Topological Polar Surface Area | 23.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 334.06396 |
| Monoisotopic Mass | 334.06396 |
| Heavy Atoms | 22 |
| Complexity | 379.0 |
Chemical Identifiers
| CAS Number | 33754-55-1 |
|---|---|
| SMILES | C1CN(CCN1C2=CC=CC=C2)C(=O)C3=CC(=C(C=C3)Cl)Cl |
| InChIKey | SUDWSSFSLCVDAD-UHFFFAOYSA-N |
Product Overview
(3,4-Dichlorophenyl)-(4-phenylpiperazin-1-yl)methanone (CAS 33754-55-1), with molecular formula C17H16Cl2N2O and molecular weight 334.06396 g/mol. IUPAC: (3,4-dichlorophenyl)-(4-phenylpiperazin-1-yl)methanone.
(3,4-Dichlorophenyl)-(4-phenylpiperazin-1-yl)methanone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »