N-Benzyl(triphenyl)methanamine
N-benzyl-1,1,1-triphenylmethanamine
Also Known As: Benzyltritylamine|Tritylbenzylamine|N-Tritylbenzylamine|Benzylamine, N-trityl-|benzyl(triphenylmethyl)amine|N-Benzyl(triphenyl)methanamine|N-Tritylbenzenemethanamine|N-Benzyltriphenylmethaneamine|N-Benzyl(triphenyl)methanamine #|N-benzyl-1,1,1-triphenylmethanamine|alpha,alpha-Diphenyl-N-benzylbenzenemethanamine|Benzylamine, N-trityl-;N-benzyl-1,1,1-triphenylmethanamine;(c) paragraph sign,(c) paragraph sign-Diphenyl-N-benzylbenzenemethanamine
| Molecular Formula | C26H23N |
|---|---|
| Molecular Weight | 349.18304 g/mol |
| LogP | 6.0 |
| Topological Polar Surface Area | 12.0 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Exact Mass | 349.18304 |
| Monoisotopic Mass | 349.18304 |
| Heavy Atoms | 27 |
| Complexity | 360.0 |
Chemical Identifiers
| CAS Number | 3378-73-2 |
|---|---|
| SMILES | C1=CC=C(C=C1)CNC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
| InChIKey | KHCIKYIRXBURMY-UHFFFAOYSA-N |
Product Overview
N-Benzyl(triphenyl)methanamine (CAS 3378-73-2), with molecular formula C26H23N and molecular weight 349.18304 g/mol. IUPAC: N-benzyl-1,1,1-triphenylmethanamine.
N-Benzyl(triphenyl)methanamine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »