Bis(p-phenoxyphenyl) ether
1-phenoxy-4-(4-phenoxyphenoxy)benzene
Also Known As: Bis(p-phenoxyphenyl) ether|Bis ether|4,4'-oxybis(phenoxybenzene)|4,4'-diphenoxydiphenyl ether|Ether, bis(p-phenoxyphenyl)|1,1'-Oxybis(4-phenoxybenzene)|1-Phenoxy-4-(4-phenoxyphenoxy)benzene|4,4'-Diphenoxydiphenylather|Benzene, 1,1'-oxybis[4-phenoxy-|Benzene, 1,1'-oxybis*4-phenoxy-|(Tert.-butyldiMethylsilyloxy)ethanol|1,1a(2)-Oxybis[4-phenoxybenzene]|1-Phenoxy-4-(4-phenoxyphenoxy)benzene #|1,1'-{Oxybis[(4,1-phenylene)oxy]}dibenzene|4,4 inverted exclamation mark -Oxybis(phenoxybenzene)
| Molecular Formula | C24H18O3 |
|---|---|
| Molecular Weight | 354.12558 g/mol |
| LogP | 7.3 |
| Topological Polar Surface Area | 27.7 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Exact Mass | 354.12558 |
| Monoisotopic Mass | 354.12558 |
| Heavy Atoms | 27 |
| Complexity | 360.0 |
Chemical Identifiers
| CAS Number | 3379-41-7 |
|---|---|
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)OC3=CC=C(C=C3)OC4=CC=CC=C4 |
| InChIKey | GQGTXJRZSBTHOB-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 12 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Bis(p-phenoxyphenyl) ether (CAS 3379-41-7), with molecular formula C24H18O3 and molecular weight 354.12558 g/mol. IUPAC: 1-phenoxy-4-(4-phenoxyphenoxy)benzene.