N-{2-[(4-chlorophenyl)sulfonyl]ethyl}-3-(phenylsulfonyl)propanamide
3-(benzenesulfonyl)-N-[2-(4-chlorophenyl)sulfonylethyl]propanamide
Also Known As: KS-00002XRK|10K-535S|N-{2-[(4-chlorophenyl)sulfonyl]ethyl}-3-(phenylsulfonyl)propanamide|3-(benzenesulfonyl)-N-[2-(4-chlorobenzenesulfonyl)ethyl]propanamide|3-(benzenesulfonyl)-N-[2-(4-chlorophenyl)sulfonylethyl]propanamide|N-(2-[(4-CHLOROPHENYL)SULFONYL]ETHYL)-3-(PHENYLSULFONYL)PROPANAMIDE
| Molecular Formula | C17H18ClNO5S2 |
|---|---|
| Molecular Weight | 415.0315 g/mol |
| LogP | 2.0939 |
| Topological Polar Surface Area | 97.38 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Exact Mass | 415.0315 |
| Monoisotopic Mass | 415.0315 |
| Heavy Atoms | 26 |
| Complexity | 955.97266 |
Chemical Identifiers
| CAS Number | 337923-29-2 |
|---|---|
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CCC(=O)NCCS(=O)(=O)C2=CC=C(C=C2)Cl |
Product Overview
N-{2-[(4-chlorophenyl)sulfonyl]ethyl}-3-(phenylsulfonyl)propanamide (CAS 337923-29-2), with molecular formula C17H18ClNO5S2 and molecular weight 415.0315 g/mol. IUPAC: 3-(benzenesulfonyl)-N-[2-(4-chlorophenyl)sulfonylethyl]propanamide.
N-{2-[(4-chlorophenyl)sulfonyl]ethyl}-3-(phenylsulfonyl)propanamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »