AC1O4SEL
(E)-2-[3-[(4-chlorophenyl)methylsulfanyl]-6-methyl-1,2,4-triazin-5-yl]-N-[(4-fluorophenyl)methoxy]ethenamine
Also Known As: 2L-311S|3-((4-Chlorobenzyl)sulfanyl)-5-(2-(((4-fluorobenzyl)oxy)amino)vinyl)-6-methyl-1,2,4-triazine|(E)-2-[3-[(4-chlorophenyl)methylsulfanyl]-6-methyl-1,2,4-triazin-5-yl]-N-[(4-fluorophenyl)methoxy]ethenamine|[(E)-2-(3-{[(4-chlorophenyl)methyl]sulfanyl}-6-methyl-1,2,4-triazin-5-yl)ethenyl][(4-fluorophenyl)methoxy]amine|N-(2-{3-[(4-chlorobenzyl)sulfanyl]-6-methyl-1,2,4-triazin-5-yl}vinyl)-O-(4-fluorobenzyl)hydroxylamine
| Molecular Formula | C20H18ClFN4OS |
|---|---|
| Molecular Weight | 416.0874 g/mol |
| LogP | 4.95692 |
| Topological Polar Surface Area | 59.93 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Exact Mass | 416.0874 |
| Monoisotopic Mass | 416.0874 |
| Heavy Atoms | 28 |
| Complexity | 935.9407 |
Chemical Identifiers
| CAS Number | 338775-67-0 |
|---|---|
| SMILES | CC1=C(N=C(N=N1)SCC2=CC=C(C=C2)Cl)/C=C/NOCC3=CC=C(C=C3)F |
Product Overview
AC1O4SEL (CAS 338775-67-0), with molecular formula C20H18ClFN4OS and molecular weight 416.0874 g/mol. IUPAC: (E)-2-[3-[(4-chlorophenyl)methylsulfanyl]-6-methyl-1,2,4-triazin-5-yl]-N-[(4-fluorophenyl)methoxy]ethenamine.