2,2'-Bithiophene-5-carboxylic acid
5-thiophen-2-ylthiophene-2-carboxylic acid
Also Known As: 2,2'-Bithiophene-5-carboxylic acid|[2,2'-Bithiophene]-5-carboxylic acid|2,2'-Bithiophene-5-CA|5-carboxyl bithiophene|5-thiophen-2-ylthiophene-2-carboxylic acid|2,2-Bithiophene-5-carboxylic acid|5-carboxy-2,2'-bithiophene|[2,2'-Bithiophene]-5-carboxylicacid|2,2'-bithienyl-5'-carboxylic|4-(Trifluoromethyl)benzhydrazide|5-(thiophen-2-yl)thiophene-2-carboxylic acid|Fr13170|[2,2']Bithiophenyl-5-carboxylic acid|5-(2-thienyl)-2-thiophenecarboxylic acid|5-(2-thienyl)thiophene-2-carboxylic acid|SDCCGMLS-0065981.P001|2,2''-Bithiophene-5-carboxylic Acid|2,2 -Bithiophene-5-carboxylic acid|(2,2 -Bithiophene)-5-carboxylic acid
| Molecular Formula | C9H6O2S2 |
|---|---|
| Molecular Weight | 209.98093 g/mol |
| LogP | 2.8 |
| Topological Polar Surface Area | 93.8 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 209.98093 |
| Monoisotopic Mass | 209.98093 |
| Heavy Atoms | 13 |
| Complexity | 208.0 |
Chemical Identifiers
| CAS Number | 339-59-3 |
|---|---|
| SMILES | C1=CSC(=C1)C2=CC=C(S2)C(=O)O |
| InChIKey | PTNWHEHDBNNKEO-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 6 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2,2'-Bithiophene-5-carboxylic acid (CAS 339-59-3), with molecular formula C9H6O2S2 and molecular weight 209.98093 g/mol. IUPAC: 5-thiophen-2-ylthiophene-2-carboxylic acid.