AC1Q5YJM
butyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid
Also Known As: Methyl methacrylate butyl methacrylate methacrylic acid polymer|(C8-H14-O2.C5-H8-O2.C4-H6-O2)x-|Butyl methacrylate, methyl methacrylate, methacrylic acid polymer|butyl 2-methylprop-2-enoate; methyl 2-methylprop-2-enoate; 2-methylprop-2-enoic acid|butyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid|Methyl methacrylate, butyl methacrylate, methacrylic acid polymer|2-Propenoic acid, 2-methyl-, polymer with butyl 2-methyl-2-propenoate and methyl 2-methyl-2-propenoate|2-Propenoic acid,2-methyl-,polymers,polymer with butyl 2-methyl-2-propenoate and methyl 2-methyl-2-propenoate
| Molecular Formula | C17H28O6 |
|---|---|
| Molecular Weight | 328.1886 g/mol |
| LogP | 3.2884 |
| Topological Polar Surface Area | 89.9 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Exact Mass | 328.1886 |
| Monoisotopic Mass | 328.1886 |
| Heavy Atoms | 23 |
| Complexity | 305.0 |
Chemical Identifiers
| CAS Number | 33982-92-2 |
|---|---|
| SMILES | CCCCOC(=O)C(=C)C.CC(=C)C(=O)O.CC(=C)C(=O)OC |
| InChIKey | AFWQKFIHPQKBTK-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
AC1Q5YJM (CAS 33982-92-2), with molecular formula C17H28O6 and molecular weight 328.1886 g/mol. IUPAC: butyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid.