Sinomenine
(1R,9S,10S)-3-hydroxy-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one
Also Known As: Sinomenine|Kukoline|Cucoline|Coculine|Sabianine A|cuculine|Sinomenine HCl|Sinomenine CRS|SINOMENIN|Cucoline, Kukoline|Orientvine stem HRS|COCCULINE|Sinomenine (Cucoline)|SINOMENINE [MI]|Spectrum2_001242|Spectrum3_001134|Spectrum4_001981|Spectrum5_001621|UPCMLD-DP085|sinomenine A bismethyliodide|SINOMENINE [WHO-DD]|BSPBio_002627|KBioGR_002508|SPECTRUM1505253|EINECS 204-094-6|SPBio_001144|NP51|hydroxy-dimethoxy-methyl-[?]one|UPCMLD-DP085:001|BCBcMAP01_000195|ERK5-6O17|KBio3_002127
| Molecular Formula | C19H23NO4 |
|---|---|
| Molecular Weight | 329.16272 g/mol |
| LogP | 2.0181 |
| Topological Polar Surface Area | 59.0 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Exact Mass | 329.16272 |
| Monoisotopic Mass | 329.16272 |
| Heavy Atoms | 24 |
| Complexity | 741.1275 |
Chemical Identifiers
| CAS Number | 34081-75-9 |
|---|---|
| SMILES | CN1CC[C@@]23CC(=O)C(=C[C@@H]2[C@@H]1CC4=C3C(=C(C=C4)OC)O)OC |
Product Overview
Sinomenine (CAS 34081-75-9), with molecular formula C19H23NO4 and molecular weight 329.16272 g/mol. IUPAC: (1R,9S,10S)-3-hydroxy-4,12-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one.