3-[(4-Methylbenzyl)oxy]-2-thiophenecarboxylic acid
3-[(4-methylphenyl)methoxy]thiophene-2-carboxylic acid
Also Known As: 3-[(4-methylbenzyl)oxy]-2-thiophenecarboxylic acid|Oprea1_785512|3-[(4-methylphenyl)methoxy]thiophene-2-carboxylic Acid|KS-00001Z2R|methylbenzyloxythiophenecarboxylicacid|aminonitrophenoxyethylidenemalononitrile|3-((4-Methylbenzyl)oxy)thiophene-2-carboxylic acid|3-(p-tolylmethoxy)thiophene-2-carboxylic acid|7D-030|3-((4-Methylbenzyl)oxy)thiophene-2-carboxylicacid|3-(4-Methylbenzyl)Oxy-2-Thiophenecarboxylic Acid|SR-01000748549-2|2-Thiophenecarboxylic acid, 3-[(4-methylphenyl)methoxy]-
| Molecular Formula | C13H12O3S |
|---|---|
| Molecular Weight | 248.05072 g/mol |
| LogP | 3.33372 |
| Topological Polar Surface Area | 46.53 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 248.05072 |
| Monoisotopic Mass | 248.05072 |
| Heavy Atoms | 17 |
| Complexity | 513.71576 |
Chemical Identifiers
| CAS Number | 343375-89-3 |
|---|---|
| SMILES | CC1=CC=C(C=C1)COC2=C(SC=C2)C(=O)O |
Product Overview
3-[(4-Methylbenzyl)oxy]-2-thiophenecarboxylic acid (CAS 343375-89-3), with molecular formula C13H12O3S and molecular weight 248.05072 g/mol. IUPAC: 3-[(4-methylphenyl)methoxy]thiophene-2-carboxylic acid.