(4-Bromophenyl)(4-(trifluoromethoxy)phenyl)methanone
(4-bromophenyl)-[4-(trifluoromethoxy)phenyl]methanone
Also Known As: 4-bromo-4'-(trifluoromethoxy)benzophenone|(4-Bromophenyl)(4-(trifluoromethoxy)phenyl)methanone|(4-bromophenyl)-[4-(trifluoromethoxy)phenyl]methanone|4-Trifluoromethoxy-4'-bromobenzophenone|(4-Bromo-phenyl)-(4-trifluoromethoxy-phenyl)-methanone|4-bromo-4'-trifluoromethoxy-benzophenone|(4-Bromophenyl)[4-(trifluoromethoxy)phenyl]methanone|4A,5,8,8a-Tetrahydro-[1,4]naphthoquinone|Methanone,(4-bromophenyl)[4-(trifluoromethoxy)phenyl]-|(4-Bromophenyl)[4-(trifluoromethoxy)phenyl]methanone #
| Molecular Formula | C14H8BrF3O2 |
|---|---|
| Molecular Weight | 343.96597 g/mol |
| LogP | 5.1 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Exact Mass | 343.96597 |
| Monoisotopic Mass | 343.96597 |
| Heavy Atoms | 20 |
| Complexity | 330.0 |
Chemical Identifiers
| CAS Number | 34367-36-7 |
|---|---|
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)Br)OC(F)(F)F |
| InChIKey | BXPDDFIILBUHCI-UHFFFAOYSA-N |
Product Overview
(4-Bromophenyl)(4-(trifluoromethoxy)phenyl)methanone (CAS 34367-36-7), with molecular formula C14H8BrF3O2 and molecular weight 343.96597 g/mol. IUPAC: (4-bromophenyl)-[4-(trifluoromethoxy)phenyl]methanone.
(4-Bromophenyl)(4-(trifluoromethoxy)phenyl)methanone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »