3-Chloro-6-nitro-1-benzothiophene-2-carbonyl chloride
3-chloro-6-nitro-1-benzothiophene-2-carbonyl chloride
Also Known As: 3-Chloro-6-nitro-1-benzothiophene-2-carbonyl chloride|Benzo[b]thiophene-2-carbonyl chloride, 3-chloro-6-nitro-|3-Chloro-6-nitro-benzo[b]thiophene-2-carbonyl chloride|3-chloro-6-nitro-benzothiophene-2-carbonyl chloride|3-Chlor-6-nitro-benzo--thiophen-2-carbonsaeurechlorid|3-Chloro-6-nitrobenzo[b]thiophene-2-carbonyl chloride|3-Chloro-6-nitro-1-benzothiophene-2-carbonyl chloride #|Benzothiophene-2-carboxylic acid chloroanhydride, 3-chloro-6-nitro-|N/A
| Molecular Formula | C9H3Cl2NO3S |
|---|---|
| Molecular Weight | 274.92108 g/mol |
| LogP | 4.2 |
| Topological Polar Surface Area | 91.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Exact Mass | 274.92108 |
| Monoisotopic Mass | 274.92108 |
| Heavy Atoms | 16 |
| Complexity | 322.0 |
Chemical Identifiers
| CAS Number | 34576-82-4 |
|---|---|
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])SC(=C2Cl)C(=O)Cl |
| InChIKey | GHFFWMJYYLDQHG-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
3-Chloro-6-nitro-1-benzothiophene-2-carbonyl chloride (CAS 34576-82-4), with molecular formula C9H3Cl2NO3S and molecular weight 274.92108 g/mol. IUPAC: 3-chloro-6-nitro-1-benzothiophene-2-carbonyl chloride.
3-Chloro-6-nitro-1-benzothiophene-2-carbonyl chloride is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »