![Benzenesulfinic acid, methyl-, bis[4-(dimethylamino)phenyl]methyl ester structure](/static/products/3461/34612-38-9.webp)
Benzenesulfinic acid, methyl-, bis[4-(dimethylamino)phenyl]methyl ester
bis[4-(dimethylamino)phenyl]methyl 2-methylbenzenesulfinate
Also Known As: Amylotetraose|Bis(p-(dimethylamino)phenyl)methyl toluenesulphinate|bis[p- phenyl]methyltoluenesulphinate|bis[p-(Dimethylamino)phenyl]methyl toluenesulfinate|Bis[p-(dimethylamino)phenyl]methyl toluenesulphinate|Benzenesulfinic acid, methyl-, bis(4-(dimethylamino)phenyl)methyl ester|Benzenesulfinic acid, methyl-, bis[4-(dimethylamino)phenyl]methyl ester|bis(4-dimethylaminophenyl)methyl 2-methylbenzenesulfinate|Bis[4-(dimethylamino)phenyl]methyl 2-methylbenzene-1-sulfinate|Benzenesulfinic acid,methyl-, bis[4-(dimethylamino)phenyl]methyl ester
| Molecular Formula | C24H28N2O2S |
|---|---|
| Molecular Weight | 408.18716 g/mol |
| LogP | 5.3 |
| Topological Polar Surface Area | 52.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Exact Mass | 408.18716 |
| Monoisotopic Mass | 408.18716 |
| Heavy Atoms | 29 |
| Complexity | 483.0 |
Chemical Identifiers
| CAS Number | 34612-38-9 |
|---|---|
| SMILES | CC1=CC=CC=C1S(=O)OC(C2=CC=C(C=C2)N(C)C)C3=CC=C(C=C3)N(C)C |
| InChIKey | KDHYJULAYMXQIW-UHFFFAOYSA-N |
Product Overview
Benzenesulfinic acid, methyl-, bis[4-(dimethylamino)phenyl]methyl ester (CAS 34612-38-9), with molecular formula C24H28N2O2S and molecular weight 408.18716 g/mol. IUPAC: bis[4-(dimethylamino)phenyl]methyl 2-methylbenzenesulfinate.