2-(4-Fluorophenyl)-1-phenylethanone
2-(4-fluorophenyl)-1-phenylethanone
Also Known As: 2-(4-fluorophenyl)-1-phenylethanone|2-(4-Fluorophenyl)acetophenone|4-fluorobenzyl phenyl ketone|2- ACETOPHENONE|4 -Fluorodeoxybenzoin|4-fluorophenylacetophenone|2-(4-fluorophenyl)-1-phenylethan-1-one|(4-fluorophenyl)acetophenone|(4'-fluorophenyl)acetophenone|4-Fluoro-2-Phenylacetophenone|alpha-(4-Fluorophenyl)acetophenone|alpha-(p-fluorophenyl)-acetophenone|1080AE|Ethanone,2-(4-fluorophenyl)-1-phenyl-|1-Phenyl-2-(4-fluorophenyl)ethanone|Ethanone, 2-(4-fluorophenyl)-1-phenyl-|2-(4-fluorophenyl)-1-phenyl ethanone|2-(4-fluorophenyl)-1-phenyl-Ethanone|2-(4-fluoro-phenyl)-1-phenyl-ethanone|2-(4-fluorophenyl)-1-phenyl-1-ethanone|4CH-001042
| Molecular Formula | C14H11FO |
|---|---|
| Molecular Weight | 214.07939 g/mol |
| LogP | 3.3 |
| Topological Polar Surface Area | 17.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 214.07939 |
| Monoisotopic Mass | 214.07939 |
| Heavy Atoms | 16 |
| Complexity | 225.0 |
Chemical Identifiers
| CAS Number | 347-84-2 |
|---|---|
| SMILES | C1=CC=C(C=C1)C(=O)CC2=CC=C(C=C2)F |
| InChIKey | CWYRBOMWOQXYFZ-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 5 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-(4-Fluorophenyl)-1-phenylethanone (CAS 347-84-2), with molecular formula C14H11FO and molecular weight 214.07939 g/mol. IUPAC: 2-(4-fluorophenyl)-1-phenylethanone.
2-(4-Fluorophenyl)-1-phenylethanone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »