N,N'-Ethylenedianthranilic Acid
2-[2-(2-carboxyanilino)ethylamino]benzoic acid
Also Known As: N,N'-Ethylenedianthranilic Acid|ethylenedianthranilic acid|ACMC-20aj77|N,N-EthylenedianthranilicAcid|N,N-Ethylenedianthranilic Acid|N,N -Ethylenedianthanilic acid|2-[2-(2-carboxyanilino)ethylamino]benzoic acid|2,2'-(1,2-Ethanediyldiimino)dibenzoic acid|2,2 -(Ethylenebisimino)dibenzoic acid|2,2 -(Ethylenebisimino)bisbenzoic acid|2,2'-(ethane-1,2-diyldiimino)dibenzoic acid|1,2-Ethanediamine, N,N'-di(2-carboxyphenyl)-|2-([2-(2-Carboxyanilino)ethyl]amino)benzoic acid|2-([2-(2-Carboxyanilino)ethyl]amino)benzoic acid #|2-({2-[(2-CARBOXYPHENYL)AMINO]ETHYL}AMINO)BENZOIC ACID|2,2 inverted exclamation mark -[Ethane-1,2-diylbis(azanediyl)]dibenzoic Acid
| Molecular Formula | C16H16N2O4 |
|---|---|
| Molecular Weight | 300.111 g/mol |
| LogP | 3.8 |
| Topological Polar Surface Area | 98.7 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Exact Mass | 300.111 |
| Monoisotopic Mass | 300.111 |
| Heavy Atoms | 22 |
| Complexity | 352.0 |
Chemical Identifiers
| CAS Number | 34827-82-2 |
|---|---|
| SMILES | C1=CC=C(C(=C1)C(=O)O)NCCNC2=CC=CC=C2C(=O)O |
| InChIKey | BMRDIJXIHSOUFN-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
N,N'-Ethylenedianthranilic Acid (CAS 34827-82-2), with molecular formula C16H16N2O4 and molecular weight 300.111 g/mol. IUPAC: 2-[2-(2-carboxyanilino)ethylamino]benzoic acid.