2-Hydroxyethyl 2-methylprop-2-enoate--2-methoxyethyl 2-methylprop-2-enoate (1/1)
2-hydroxyethyl 2-methylprop-2-enoate;2-methoxyethyl 2-methylprop-2-enoate
Also Known As: (C7-H12-O3.C6-H10-O3)x-|2-Hydroxyethyl methacrylate, methoxyethyl methacrylate polymer|2-Propenoic acid, 2-methyl-, 2-hydroxyethyl ester, polymer with 2-methoxyethyl 2-methyl-2-propenoate|2-hydroxyethyl 2-methylprop-2-enoate- 2-methoxyethyl 2-methylprop-2-enoate(1:1)|2-Hydroxyethyl 2-methylprop-2-enoate--2-methoxyethyl 2-methylprop-2-enoate (1/1)|2-hydroxyethyl 2-methylprop-2-enoate; 2-methoxyethyl 2-methylprop-2-enoate
| Molecular Formula | C13H22O6 |
|---|---|
| Molecular Weight | 274.14163 g/mol |
| LogP | 0.8501 |
| Topological Polar Surface Area | 82.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Exact Mass | 274.14163 |
| Monoisotopic Mass | 274.14163 |
| Heavy Atoms | 19 |
| Complexity | 246.0 |
Chemical Identifiers
| CAS Number | 34844-07-0 |
|---|---|
| SMILES | CC(=C)C(=O)OCCO.CC(=C)C(=O)OCCOC |
| InChIKey | DBVGDYOGBAYKRO-UHFFFAOYSA-N |
Product Overview
2-Hydroxyethyl 2-methylprop-2-enoate--2-methoxyethyl 2-methylprop-2-enoate (1/1) (CAS 34844-07-0), with molecular formula C13H22O6 and molecular weight 274.14163 g/mol. IUPAC: 2-hydroxyethyl 2-methylprop-2-enoate;2-methoxyethyl 2-methylprop-2-enoate.