3-Methyl-1-phenylphospholane 1-oxide
3-methyl-1-phenyl-1λ5-phospholane 1-oxide
Also Known As: 3-methyl-1-phenyl-1|3-methyl-P-phenylphospholane oxide|3-Methyl-1-phenylphospholane 1-oxide|3-methyl-1-phenylphospholane-1-oxide|Phospholane,3-methyl-1-phenyl-,1-oxide|3-methyl-1-phenylphospholan-1-ium-1-olate|Phospholane, 3-methyl-1-phenyl-, 1-oxide|3-methyl-1-phenyl-1|E5-phospholane 1-oxide|J2.759.099C|3-Methyl-1-phenyl-1lambda~5~-phospholan-1-one|1-Phenyl-3-methyltetrahydro-1H-phosphole 1-oxide|3-methyl-1-phenyl-1$l^{5}-phospholane 1-oxide|1-Phenyl-3-methyl-2,3,4,5-tetrahydro-1H-phosphole 1-oxide
| Molecular Formula | C11H15OP |
|---|---|
| Molecular Weight | 194.08606 g/mol |
| LogP | 1.9 |
| Topological Polar Surface Area | 17.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Exact Mass | 194.08606 |
| Monoisotopic Mass | 194.08606 |
| Heavy Atoms | 13 |
| Complexity | 218.0 |
Chemical Identifiers
| CAS Number | 34868-22-9 |
|---|---|
| SMILES | CC1CCP(=O)(C1)C2=CC=CC=C2 |
| InChIKey | NMWVKRPDPIADRN-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 5 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
3-Methyl-1-phenylphospholane 1-oxide (CAS 34868-22-9), with molecular formula C11H15OP and molecular weight 194.08606 g/mol. IUPAC: 3-methyl-1-phenyl-1λ5-phospholane 1-oxide.