1-Fluoro-5-methyl-2,4-dinitrobenzene
1-fluoro-5-methyl-2,4-dinitrobenzene
Also Known As: 2,4-Dinitro-5-fluorotoluene|1-fluoro-5-methyl-2,4-dinitrobenzene|null|5-fluoro-2,4-dinitrotoluene|Toluene,3-fluoro-4,6-dinitro|KS-00000EOJ|1-Fluoro-5-methyl-2,4-dinitro-benzene|Toluene, 3-fluoro-4,6-dinitro-|Benzene,1-fluoro-5-methyl-2,4-dinitro-|2 pound not4-Dinitro-5-fluorotoluene|2,4-Dinitro-1-fluoro-5-methylbenzene|5-fluoro-1-methyl-2,4-dinitrobenzene|Benzene, 1-fluoro-5-methyl-2,4-dinitro-|W-2605|I01-5574|7-(4-BROMO-PHENYL)-3H-THIENO[3,2-D]PYRIMIDIN-4-ONE
| Molecular Formula | C7H5FN2O4 |
|---|---|
| Molecular Weight | 200.02333 g/mol |
| LogP | 2.0 |
| Topological Polar Surface Area | 91.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 0 |
| Exact Mass | 200.02333 |
| Monoisotopic Mass | 200.02333 |
| Heavy Atoms | 14 |
| Complexity | 249.0 |
Chemical Identifiers
| CAS Number | 349-01-9 |
|---|---|
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])F |
| InChIKey | CMIMRMOSIVTUAA-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 5 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1-Fluoro-5-methyl-2,4-dinitrobenzene (CAS 349-01-9), with molecular formula C7H5FN2O4 and molecular weight 200.02333 g/mol. IUPAC: 1-fluoro-5-methyl-2,4-dinitrobenzene.