N-[4-[acetyl(methyl)amino]phenyl]-9H-xanthene-9-carboxamide
N-[4-[acetyl(methyl)amino]phenyl]-9H-xanthene-9-carboxamide
Also Known As: Oprea1_075434|Oprea1_563539|BAS 03033819|AB00111464-01|SR-01000476621-1|N-(4-(N-methylacetamido)phenyl)-9H-xanthene-9-carboxamide|N-methyl-N-[4-(xanthen-9-ylcarbonylamino)phenyl]acetamide|N-[4-[acetyl(methyl)amino]phenyl]-9H-xanthene-9-carboxamide|N-{4-[acetyl(methyl)amino]phenyl}-9H-xanthene-9-carboxamide|N-[4-(N-METHYLACETAMIDO)PHENYL]-9H-XANTHENE-9-CARBOXAMIDE|9H-Xanthene-9-carboxylic acid [4-(acetyl-methyl-amino)-phenyl]-amide
| Molecular Formula | C23H20N2O3 |
|---|---|
| Molecular Weight | 372.1474 g/mol |
| LogP | 4.5456 |
| Topological Polar Surface Area | 58.64 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 372.1474 |
| Monoisotopic Mass | 372.1474 |
| Heavy Atoms | 28 |
| Complexity | 998.2229 |
Chemical Identifiers
| CAS Number | 349441-99-2 |
|---|---|
| SMILES | CC(=O)N(C)C1=CC=C(C=C1)NC(=O)C2C3=CC=CC=C3OC4=CC=CC=C24 |
Product Overview
N-[4-[acetyl(methyl)amino]phenyl]-9H-xanthene-9-carboxamide (CAS 349441-99-2), with molecular formula C23H20N2O3 and molecular weight 372.1474 g/mol. IUPAC: N-[4-[acetyl(methyl)amino]phenyl]-9H-xanthene-9-carboxamide.
N-[4-[acetyl(methyl)amino]phenyl]-9H-xanthene-9-carboxamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »