AC1LZ5KY
5-[(4-methoxyphenyl)methylsulfanyl]-12,12-dimethyl-4-phenyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one
Also Known As: AJ-292/13049160|2-[(4-methoxybenzyl)sulfanyl]-6,6-dimethyl-3-phenyl-3,5,6,8-tetrahydro-4H-pyrano[4',3':4,5]thieno[2,3-d]pyrimidin-4-one|2-((4-methoxybenzyl)thio)-6,6-dimethyl-3-phenyl-5,6-dihydro-3H-pyrano[4',3':4,5]thieno[2,3-d]pyrimidin-4(8H)-one|2-[(4-methoxyphenyl)methylsulfanyl]-6,6-dimethyl-3-phenyl-5,8-dihydropyrano[2,3]thieno[2,4-b]pyrimidin-4-one
| Molecular Formula | C25H24N2O3S2 |
|---|---|
| Molecular Weight | 464.12283 g/mol |
| LogP | 5.5994 |
| Topological Polar Surface Area | 53.35 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Exact Mass | 464.12283 |
| Monoisotopic Mass | 464.12283 |
| Heavy Atoms | 32 |
| Complexity | 1325.5586 |
Chemical Identifiers
| CAS Number | 351007-50-6 |
|---|---|
| SMILES | CC1(CC2=C(CO1)SC3=C2C(=O)N(C(=N3)SCC4=CC=C(C=C4)OC)C5=CC=CC=C5)C |
Product Overview
AC1LZ5KY (CAS 351007-50-6), with molecular formula C25H24N2O3S2 and molecular weight 464.12283 g/mol. IUPAC: 5-[(4-methoxyphenyl)methylsulfanyl]-12,12-dimethyl-4-phenyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.