AC1MJQ37
2-[(12-amino-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl)sulfanyl]acetonitrile
Also Known As: BAS 02376334|AN-512/12674249|SR-01000315482-1|[(4-amino-6,7-dihydro-5H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-2-yl)sulfanyl]acetonitrile|2-((4-amino-6,7-dihydro-5H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-2-yl)thio)acetonitrile|2-({12-AMINO-7-THIA-9,11-DIAZATRICYCLO[6.4.0.0(2),?]DODECA-1(12),2(6),8,10-TETRAEN-10-YL}SULFANYL)ACETONITRILE|2-[(4-amino-6,7-dihydro-5H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-2-yl)sulfanyl]acetonitrile
| Molecular Formula | C11H10N4S2 |
|---|---|
| Molecular Weight | 262.0347 g/mol |
| LogP | 2.37788 |
| Topological Polar Surface Area | 75.59 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Exact Mass | 262.0347 |
| Monoisotopic Mass | 262.0347 |
| Heavy Atoms | 17 |
| Complexity | 626.41364 |
Chemical Identifiers
| CAS Number | 351007-73-3 |
|---|---|
| SMILES | C1CC2=C(C1)SC3=NC(=NC(=C23)N)SCC#N |
Product Overview
AC1MJQ37 (CAS 351007-73-3), with molecular formula C11H10N4S2 and molecular weight 262.0347 g/mol. IUPAC: 2-[(12-amino-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl)sulfanyl]acetonitrile.