![[2,2'-Bithiophene]-5,5'-dicarboxylic acid structure](/static/products/3515/3515-34-2.webp)
[2,2'-Bithiophene]-5,5'-dicarboxylic acid
5-(5-carboxythiophen-2-yl)thiophene-2-carboxylic acid
Also Known As: [2,2'-Bithiophene]-5,5'-dicarboxylic acid|Ammoniumfluoride|[2,2'-Bithiophene]-5,5'-dicarboxylicacid|CBDivE_010512|YSZC1256|5-(5-carboxythiophen-2-yl)thiophene-2-carboxylic acid|2,2'-BITHIOPHENE-5,5'-DICARBOXYLIC ACID|2,2 -Bi[thiophene-5-carboxylic acid]|2,2'-bithiophene-5,5'-dicarcoxylic acid|J2.107.076I|2,2 -Bithiophene-5,5 -dicarboxylic acid|2,2''-BITHIOPHENE-5,5''-DICARBOXYLICACID|SR-01000201292-1
| Molecular Formula | C10H6O4S2 |
|---|---|
| Molecular Weight | 253.97075 g/mol |
| LogP | 2.7 |
| Topological Polar Surface Area | 131.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Exact Mass | 253.97075 |
| Monoisotopic Mass | 253.97075 |
| Heavy Atoms | 16 |
| Complexity | 277.0 |
Chemical Identifiers
| CAS Number | 3515-34-2 |
|---|---|
| SMILES | C1=C(SC(=C1)C(=O)O)C2=CC=C(S2)C(=O)O |
| InChIKey | DDFHBQSCUXNBSA-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
[2,2'-Bithiophene]-5,5'-dicarboxylic acid (CAS 3515-34-2), with molecular formula C10H6O4S2 and molecular weight 253.97075 g/mol. IUPAC: 5-(5-carboxythiophen-2-yl)thiophene-2-carboxylic acid.