6-Methoxy-3-methyl-1-benzofuran-2-carboxylic acid
6-methoxy-3-methyl-1-benzofuran-2-carboxylic acid
Also Known As: 6-Methoxy-3-methyl-1-benzofuran-2-carboxylic acid|6-Methoxy-3-methyl-benzofuran-2-carboxylic acid|6-methoxy-3-methylbenzofuran-2-carboxylic acid|Oprea1_860448|CBDivE_009427|2-Benzofurancarboxylic acid, 6-methoxy-3-methyl-|7947AC|BAS 01589412|3-Methyl-6-methoxybenzofuran-2-carboxylic acid|6-Methoxy-3-methyl-2-benzofurancarboxylic acid|2-(2-Pyrrolidin-1-yl-ethoxy)-benzaldehyde|6-methoxy-3-methylbenzofuran-2-carboxylicacid|J1.391.608J|W-7242|AB00073923-01|410M294|6-methoxy-3-methylbenzo[b]furan-2-carboxylic acid|1-(2-METHYL-1,3-THIAZOL-4-YL)ETHANAMINE|SR-01000195705-1
| Molecular Formula | C11H10O4 |
|---|---|
| Molecular Weight | 206.0579 g/mol |
| LogP | 2.5 |
| Topological Polar Surface Area | 59.7 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 206.0579 |
| Monoisotopic Mass | 206.0579 |
| Heavy Atoms | 15 |
| Complexity | 253.0 |
Chemical Identifiers
| CAS Number | 35166-80-4 |
|---|---|
| SMILES | CC1=C(OC2=C1C=CC(=C2)OC)C(=O)O |
| InChIKey | CQZZSFNTQLCLJF-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 5 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
6-Methoxy-3-methyl-1-benzofuran-2-carboxylic acid (CAS 35166-80-4), with molecular formula C11H10O4 and molecular weight 206.0579 g/mol. IUPAC: 6-methoxy-3-methyl-1-benzofuran-2-carboxylic acid.