AC1LEUUF
2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(4-methylphenyl)acetamide
Also Known As: 2-[4-chloro-5-methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]-N-(4-methylphenyl)acetamide|BAS 01058380|AG-690/12870393|2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(4-methylphenyl)acetamide|2-(4-Chloro-5-methyl-3-trifluoromethyl-pyrazol-1-yl)-N-p-tolyl-acetamide|2-(4-chloro-5-methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl)-N-(p-tolyl)acetamide|2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazolyl]-N-(4-methylphenyl)acetamide
| Molecular Formula | C14H13ClF3N3O |
|---|---|
| Molecular Weight | 331.06992 g/mol |
| LogP | 3.5 |
| Topological Polar Surface Area | 46.9 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Exact Mass | 331.06992 |
| Monoisotopic Mass | 331.06992 |
| Heavy Atoms | 22 |
| Complexity | 399.0 |
Chemical Identifiers
| CAS Number | 351986-59-9 |
|---|---|
| SMILES | CC1=CC=C(C=C1)NC(=O)CN2C(=C(C(=N2)C(F)(F)F)Cl)C |
| InChIKey | OXGDVCXYTOOYNW-UHFFFAOYSA-N |
Product Overview
AC1LEUUF (CAS 351986-59-9), with molecular formula C14H13ClF3N3O and molecular weight 331.06992 g/mol. IUPAC: 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(4-methylphenyl)acetamide.
AC1LEUUF is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »