AC1MEOZA
2-(3,4-dihydroxyphenyl)-5,7-dimethyl-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),9,11,13,15-pentaene-4,6,17-trione
Also Known As: Oprea1_014282|Oprea1_224424|BAS 00655808|5-(3,4-dihydroxyphenyl)-1,3-dimethyl-5,5a-dihydro-1H-indeno[2',1':5,6]pyrido[2,3-d]pyrimidine-2,4,6(3H)-trione|AK-968/37077112|2-(3,4-dihydroxyphenyl)-5,7-dimethyl-5,7,9-triazatetracyclo[8.7.0.0^{3,8}.0^{11,16}]heptadeca-3(8),9,11(16),12,14-pentaene-4,6,17-trione|2-(3,4-dihydroxyphenyl)-5,7-dimethyl-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),9,11,13,15-pentaene-4,6,17-trione
| Molecular Formula | C22H17N3O5 |
|---|---|
| Molecular Weight | 403.11682 g/mol |
| LogP | 1.574 |
| Topological Polar Surface Area | 113.89 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Exact Mass | 403.11682 |
| Monoisotopic Mass | 403.11682 |
| Heavy Atoms | 30 |
| Complexity | 1413.246 |
Chemical Identifiers
| CAS Number | 352017-01-7 |
|---|---|
| SMILES | CN1C2=C(C(C3C(=N2)C4=CC=CC=C4C3=O)C5=CC(=C(C=C5)O)O)C(=O)N(C1=O)C |
Product Overview
AC1MEOZA (CAS 352017-01-7), with molecular formula C22H17N3O5 and molecular weight 403.11682 g/mol. IUPAC: 2-(3,4-dihydroxyphenyl)-5,7-dimethyl-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),9,11,13,15-pentaene-4,6,17-trione.