1-(3-Bromo-4-methoxyphenyl)ethanone
1-(3-bromo-4-methoxyphenyl)ethanone
Also Known As: 1-(3-Bromo-4-methoxyphenyl)ethanone|3'-Bromo-4'-methoxyacetophenone|3-bromo-4-methoxyacetophenone|1-(3-bromo-4-methoxyphenyl)ethan-1-one|ACMC-1AGHJ|1- ETHANONE|3-bromo-4-methoxy-acetophenone|Ethanone, 1-(3-bromo-4-methoxyphenyl)-|1-acetyl-3-bromo-4-methoxybenzene|KS-00000C4B|CL9267|1-(3-bromo-4-methoxy-phenyl)ethanone|3 -Bromo-4 -methoxyacetophenone|CS-W021215|DS-1847|FS-1404|1-(3-bromo-4-methoxy-phenyl)-ethanone|1-(3-Bromo-4-methoxyphenyl)ethanone #|Ethanone,1-(3-bromo-4-methoxyphenyl)-|NCGC00323195-01
| Molecular Formula | C9H9BrO2 |
|---|---|
| Molecular Weight | 227.97859 g/mol |
| LogP | 2.3 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 227.97859 |
| Monoisotopic Mass | 227.97859 |
| Heavy Atoms | 12 |
| Complexity | 170.0 |
Chemical Identifiers
| CAS Number | 35310-75-9 |
|---|---|
| SMILES | CC(=O)C1=CC(=C(C=C1)OC)Br |
| InChIKey | JYPGOBDETCKKKV-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1-(3-Bromo-4-methoxyphenyl)ethanone (CAS 35310-75-9), with molecular formula C9H9BrO2 and molecular weight 227.97859 g/mol. IUPAC: 1-(3-bromo-4-methoxyphenyl)ethanone.