Dechloro perphenazine
2-[4-(3-phenothiazin-10-ylpropyl)piperazin-1-yl]ethanol
Also Known As: Dechloro perphenazine|Perphenazine related compound B|Phenazine (pharmaceutical)|Perphenazine EP Impurity B|CBDivE_006095|Perphenazine related compound B [USP]|Perphenazine specified impurity B|Perphenazine specified impurity B [EP]|4-(3-Phenothiazin-10-ylpropyl)-1-piperazineethanol|Perphenazine related compound B RS [USP]|Perphenazine related compound B (USP)|2-[4-(3-phenothiazin-10-ylpropyl)piperazin-1-yl]ethanol|PERPHENAZINE IMPURITY B [EP IMPURITY]|Perphenazine related compound B RS (USP)|PERPHENAZINE RELATED COMPOUND B [USP-RS]|PERPHENAZINE IMPURITY B (EP IMPURITY)|1-Piperazineethanol, 4-(3-(10H-phenothiazin-10-yl)propyl)-|2-(4-(3-(10H-Phenothiazin-10-yl)propyl)piperazin-1-yl)ethanol|PERPHENAZINE RELATED COMPOUND B (USP-RS)|PERPHENAZINE RELATED COMPOUND B [USP IMPURITY]|PERPHENAZINE RELATED COMPOUND B (USP IMPURITY)|1-Piperazineethanol, 4-(3-phenothiazin-10-ylpropyl)-|2-(4-(3-(10H-phenothiazin-10-yl)propyl)piperazin-1-yl)ethan-1-ol|4-[3-(10H-Phenothiazin-10-yl)propyl]-1-piperazineethanol|Perphenazine EP Impurity B; Perphenazine Related Compound B|1-Piperazineethanol, 4-[3-(10H-phenothiazin-10-yl)propyl]-|2-[4-[3-(10H-phenothiazin-10-yl)propyl]piperazin-1- yl]ethanol|2-[4-[3-(10H-Phenothiazin-10-yl)propyl]piperazin-1-yl]ethanol|Perphenazine Imp. B (EP); Perphenazine USP Related Compound B; Perphenazine USP RC B; 2-[4-[3-(10H-Phenothiazin-10-yl)propyl]piperazin-1-yl]ethanol; Perphenazine Related Compound B; Perphenazine Impurity B
| Molecular Formula | C21H27N3OS |
|---|---|
| Molecular Weight | 369.18747 g/mol |
| LogP | 3.2893 |
| Topological Polar Surface Area | 29.95 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Exact Mass | 369.18747 |
| Monoisotopic Mass | 369.18747 |
| Heavy Atoms | 26 |
| Complexity | 685.20105 |
Chemical Identifiers
| CAS Number | 3533-97-9 |
|---|---|
| SMILES | C1CN(CCN1CCCN2C3=CC=CC=C3SC4=CC=CC=C42)CCO |
Product Overview
Dechloro perphenazine (CAS 3533-97-9), with molecular formula C21H27N3OS and molecular weight 369.18747 g/mol. IUPAC: 2-[4-(3-phenothiazin-10-ylpropyl)piperazin-1-yl]ethanol.
Dechloro perphenazine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »