Dimethyl diallylmalonate
dimethyl 2,2-bis(prop-2-enyl)propanedioate
Also Known As: Dimethyl diallylmalonate|dimethyl 2,2-diallylmalonate|Diallylglutarate|DIALLYL GLUTARATE|dimethyl diallyl malonate|EINECS 252-526-7|dimethyl 2,2-bis(prop-2-enyl)propanedioate|diallylmalonic acid dimethyl ester|Dimethyl di(prop-2-en-1-yl)propanedioate|1,3-Dimethyl 2,2-di-2-propen-1-ylpropanedioate|1,3-dimethyl 2,2-bis(prop-2-en-1-yl)propanedioate|4,4-BIS(CARBOMETHOXY)-1,6-HEPTADIENE|Di(2-propenyl)propanedioic acid dimethyl ester|DI-2-PROPENYLPROPANEDIOIC ACID DIMETHYL ESTER|1,6-Heptadiene-4,4-dicarboxylic acid dimethyl ester|PROPANEDIOIC ACID, 2,2-DI-2-PROPEN-1-YL-, 1,3-DIMETHYL ESTER
| Molecular Formula | C11H16O4 |
|---|---|
| Molecular Weight | 212.10486 g/mol |
| LogP | 1.471 |
| Topological Polar Surface Area | 52.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Exact Mass | 212.10486 |
| Monoisotopic Mass | 212.10486 |
| Heavy Atoms | 15 |
| Complexity | 239.76149 |
Chemical Identifiers
| CAS Number | 35357-77-8 |
|---|---|
| SMILES | COC(=O)C(CC=C)(CC=C)C(=O)OC |
Product Overview
Dimethyl diallylmalonate (CAS 35357-77-8), with molecular formula C11H16O4 and molecular weight 212.10486 g/mol. IUPAC: dimethyl 2,2-bis(prop-2-enyl)propanedioate.