RefChem:1078442
2-(5-chloro-2-ethoxyphenyl)-N,N-dimethylethanamine;(E)-2-cyclohexylbut-2-enedioic acid
Also Known As: Phenethylamine, 5-chloro-beta-cyclohexyl-N,N-dimethyl-2-ethoxy-, maleate (1:1)|Benzeneethanamine, 5-chloro-beta-cyclohexyl-N,N-dimethyl-2-ethoxy-, (Z)-2-butenedioate (1:1)|Dimethylamino-1 cyclohexyl-2 (chloro-5' ethoxy-2')phenyl-2 ethane maleate [French]|5-Chloro-beta-cyclohexyl-N,N-dimethyl-2-ethoxybenzeneethanamine (Z)-2-butenedioate (1:1)|Dimethylamino-1 cyclohexyl-2 (chloro-5' ethoxy-2')phenyl-2 ethane maleate|2-(5-chloro-2-ethoxyphenyl)-N,N-dimethylethanamine; (E)-2-cyclohexylbut-2-enedioic acid
| Molecular Formula | C22H32ClNO5 |
|---|---|
| Molecular Weight | 425.1969 g/mol |
| LogP | 4.5051 |
| Topological Polar Surface Area | 87.07 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Exact Mass | 425.1969 |
| Monoisotopic Mass | 425.1969 |
| Heavy Atoms | 29 |
| Complexity | 696.44305 |
Chemical Identifiers
| CAS Number | 35366-57-5 |
|---|---|
| SMILES | CCOC1=C(C=C(C=C1)Cl)CCN(C)C.C1CCC(CC1)/C(=C\C(=O)O)/C(=O)O |
Product Overview
RefChem:1078442 (CAS 35366-57-5), with molecular formula C22H32ClNO5 and molecular weight 425.1969 g/mol. IUPAC: 2-(5-chloro-2-ethoxyphenyl)-N,N-dimethylethanamine;(E)-2-cyclohexylbut-2-enedioic acid.