5-Chloro-2-nitro-4-(trifluoromethyl)aniline
5-chloro-2-nitro-4-(trifluoromethyl)aniline
Also Known As: 5-chloro-2-nitro-4-(trifluoromethyl)aniline|4-AMINO-2-CHLORO-5-NITROBENZOTRIFLUORIDE|5-chloro-2-nitro-4-(trifluoromethyl)benzenamine|5-Chloro-2-nitro-4-trifluoromethylaniline|3-Chloro-6-nitro-4-(trifluoromethyl)Aniline|WT092|SYNQUEST 4855-7-02|CL8450|FC1169|RW3541|AC-9045|AN-7429|CC-1020|CS-W009249|GS-4085|QC-2139|KS-00000L42|4-trifluoromethyl-5-chloro-2-nitro-aniline|5-chloro-2-nitro-4-(trifluoromethyl)phenylamine
| Molecular Formula | C7H4ClF3N2O2 |
|---|---|
| Molecular Weight | 239.99133 g/mol |
| LogP | 2.8492 |
| Topological Polar Surface Area | 69.16 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 239.99133 |
| Monoisotopic Mass | 239.99133 |
| Heavy Atoms | 15 |
| Complexity | 419.4317 |
Chemical Identifiers
| CAS Number | 35375-74-7 |
|---|---|
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])N)Cl)C(F)(F)F |
Product Overview
5-Chloro-2-nitro-4-(trifluoromethyl)aniline (CAS 35375-74-7), with molecular formula C7H4ClF3N2O2 and molecular weight 239.99133 g/mol. IUPAC: 5-chloro-2-nitro-4-(trifluoromethyl)aniline.
5-Chloro-2-nitro-4-(trifluoromethyl)aniline is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »