2-Chloro-5-methylsulfonylbenzenesulfonamide
2-chloro-5-methylsulfonylbenzenesulfonamide
Also Known As: 2-chloro-5-methylsulfonylbenzenesulfonamide|2-chloro-5-(methylsulfonyl)benzenesulfonamide|2-chloro-5-methanesulfonylbenzene-1-sulfonamide|2-CHLORO-5-METHANESULFONYL-BENZENESULFONAMIDE|2-Chloro-5-methanesulfonyl-benzene|4-Chlor-3-sulfamoylphenylmethylsulfon|2-chloro-5-methanesulfonylbenzenesulfonamide|5-Methanesulfonyl-2-chlorobenzenesulfonamide|2-chloro-5-methylsulfonyl-benzenesulfonamide|Benzenesulfonamide,2-chloro-5-(methylsulfonyl)-|2-Chloro-5-(methanesulfonyl)benzene-1-sulfonamide|A3054/0128974
| Molecular Formula | C7H8ClNO4S2 |
|---|---|
| Molecular Weight | 268.9583 g/mol |
| LogP | 0.3909 |
| Topological Polar Surface Area | 94.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 268.9583 |
| Monoisotopic Mass | 268.9583 |
| Heavy Atoms | 15 |
| Complexity | 591.41626 |
Chemical Identifiers
| CAS Number | 3544-47-6 |
|---|---|
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)Cl)S(=O)(=O)N |
Product Overview
2-Chloro-5-methylsulfonylbenzenesulfonamide (CAS 3544-47-6), with molecular formula C7H8ClNO4S2 and molecular weight 268.9583 g/mol. IUPAC: 2-chloro-5-methylsulfonylbenzenesulfonamide.
2-Chloro-5-methylsulfonylbenzenesulfonamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »