(2-Fluorophenyl)-[4-(naphthalen-2-ylmethyl)piperazin-1-yl]methanone
(2-fluorophenyl)-[4-(naphthalen-2-ylmethyl)piperazin-1-yl]methanone
Also Known As: Oprea1_608361|Oprea1_787465|BAS 01042112|AB00098319-01|2-fluorophenyl 4-(2-naphthylmethyl)piperazinyl ketone|(2-fluorophenyl)-[4-(naphthalen-2-ylmethyl)piperazin-1-yl]methanone|(2-FLUOROPHENYL)[4-(2-NAPHTHYLMETHYL)PIPERAZINO]METHANONE|(2-fluorophenyl)[4-(naphthalen-2-ylmethyl)piperazin-1-yl]methanone|1-(2-FLUOROBENZOYL)-4-(NAPHTHALEN-2-YLMETHYL)PIPERAZINE|(2-Fluoro-phenyl)-(4-naphthalen-2-ylmethyl-piperazin-1-yl)-methanone
| Molecular Formula | C22H21FN2O |
|---|---|
| Molecular Weight | 348.1638 g/mol |
| LogP | 4.0 |
| Topological Polar Surface Area | 23.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 348.1638 |
| Monoisotopic Mass | 348.1638 |
| Heavy Atoms | 26 |
| Complexity | 477.0 |
Chemical Identifiers
| CAS Number | 354536-17-7 |
|---|---|
| SMILES | C1CN(CCN1CC2=CC3=CC=CC=C3C=C2)C(=O)C4=CC=CC=C4F |
| InChIKey | CGTVRVNJBIYHHQ-UHFFFAOYSA-N |
Product Overview
(2-Fluorophenyl)-[4-(naphthalen-2-ylmethyl)piperazin-1-yl]methanone (CAS 354536-17-7), with molecular formula C22H21FN2O and molecular weight 348.1638 g/mol. IUPAC: (2-fluorophenyl)-[4-(naphthalen-2-ylmethyl)piperazin-1-yl]methanone.
(2-Fluorophenyl)-[4-(naphthalen-2-ylmethyl)piperazin-1-yl]methanone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »