AC1NW97F
(E)-3-(1,3-benzodioxol-5-yl)-N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide
Also Known As: AK-968/37129185|(E)-3-(1,3-benzodioxol-5-yl)-N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide|(2E)-3-(1,3-benzodioxol-5-yl)-N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide|3-(1,3-benzodioxol-5-yl)-N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothien-2-yl)acrylamide|(2E)-3-(2H-benzo[3,4-d]1,3-dioxolan-5-yl)-N-(3-cyano-6-ethyl(4,5,6,7-tetrahydr obenzo[b]thiophen-2-yl))prop-2-enamide
| Molecular Formula | C21H20N2O3S |
|---|---|
| Molecular Weight | 380.11948 g/mol |
| LogP | 4.51528 |
| Topological Polar Surface Area | 71.35 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 380.11948 |
| Monoisotopic Mass | 380.11948 |
| Heavy Atoms | 27 |
| Complexity | 955.06683 |
Chemical Identifiers
| CAS Number | 354547-38-9 |
|---|---|
| SMILES | CCC1CCC2=C(C1)SC(=C2C#N)NC(=O)/C=C/C3=CC4=C(C=C3)OCO4 |
Product Overview
AC1NW97F (CAS 354547-38-9), with molecular formula C21H20N2O3S and molecular weight 380.11948 g/mol. IUPAC: (E)-3-(1,3-benzodioxol-5-yl)-N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide.