AC1MD8Q0
4,17-diamino-6,15-bis(4-chlorophenyl)-3,18-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),4,8,10,12,16-heptaene-5,16-dicarbonitrile
Also Known As: 2,11-diamino-4,9-bis(4-chlorophenyl)-4,9-dihydrobenzo[f]pyrano[3,2-h]chromene-3,10-dicarbonitrile|AM-807/12426061|2,11-diamino-4,9-di(4-chlorophenyl)-4,9-dihydrobenzo[f]pyrano[3,2-h]chromene-3,10-dicarbonitrile|4,17-diamino-6,15-bis(4-chlorophenyl)-3,18-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),4,8,10,12,16-heptaene-5,16-dicarbonitrile
| Molecular Formula | C30H18Cl2N4O2 |
|---|---|
| Molecular Weight | 536.0807 g/mol |
| LogP | 6.58296 |
| Topological Polar Surface Area | 118.08 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Exact Mass | 536.0807 |
| Monoisotopic Mass | 536.0807 |
| Heavy Atoms | 38 |
| Complexity | 1647.2498 |
Chemical Identifiers
| CAS Number | 354552-80-0 |
|---|---|
| SMILES | C1=CC=C2C(=C1)C3=C(C4=C2C(C(=C(O4)N)C#N)C5=CC=C(C=C5)Cl)OC(=C(C3C6=CC=C(C=C6)Cl)C#N)N |
Product Overview
AC1MD8Q0 (CAS 354552-80-0), with molecular formula C30H18Cl2N4O2 and molecular weight 536.0807 g/mol. IUPAC: 4,17-diamino-6,15-bis(4-chlorophenyl)-3,18-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),4,8,10,12,16-heptaene-5,16-dicarbonitrile.