3,3,4,4,5,5,5-Heptafluoro-2-methylpentan-2-ol
3,3,4,4,5,5,5-heptafluoro-2-methylpentan-2-ol
Also Known As: 3,3,4,4,5,5,5-heptafluoro-2-methylpentan-2-ol|2-Perfluoropropyl-2-propanol|3,3,4,4,5,5,5-Heptafluoro-2-methyl-2-pentanol|1,1,1,2,2,3,3-heptafluoro-4-methylpentan-4-ol|2-methyl-3,3,4,4,5,5,5-heptafluoro-pentan-2-ol|2-Pentanol, 3,3,4,4,5,5,5-heptafluoro-2-methyl-|2-Pentanol,3,3,4,4,5,5,5-heptafluoro-2-methyl-|3,3,4,4,5,5,5-Heptafluoro-2-methyl-2-pentanol #|3,3,4,4,5,5,5-Heptafluoro-2-methylpentan-2-ol 100g|822-861-9
| Molecular Formula | C6H7F7O |
|---|---|
| Molecular Weight | 228.03851 g/mol |
| LogP | 2.6 |
| Topological Polar Surface Area | 20.2 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Exact Mass | 228.03851 |
| Monoisotopic Mass | 228.03851 |
| Heavy Atoms | 14 |
| Complexity | 217.0 |
Chemical Identifiers
| CAS Number | 355-22-6 |
|---|---|
| SMILES | CC(C)(C(C(C(F)(F)F)(F)F)(F)F)O |
| InChIKey | CZPWXOSMOFCBOR-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
3,3,4,4,5,5,5-Heptafluoro-2-methylpentan-2-ol (CAS 355-22-6), with molecular formula C6H7F7O and molecular weight 228.03851 g/mol. IUPAC: 3,3,4,4,5,5,5-heptafluoro-2-methylpentan-2-ol.