2-Fluoro-5-(methylsulfonyl)aniline
2-fluoro-5-methylsulfonylaniline
Also Known As: 2-fluoro-5-(methylsulfonyl)aniline|2-fluoro-5-methylsulfonylaniline|2-fluoro-5-methanesulfonylaniline|2-fluoro-5-(methylsulphonyl)aniline|1H,1H-perfluoropentan-1-ol|2-FLUORO-5- ANILINE|2-fluoro-5-methylsulphonylaniline|2-fluoro-5-methylsulfonyl-aniline|2-Fluoro-5-methylsulfonylphenylamine|2-Fluoro-5-(methanesulfonyl)aniline|2-fluoro-5-methanesulfonylphenylamine|2265AE|2-fluoro-5-(methylsulfonyl)phenylamine|3-Amino-4-fluorophenyl methyl sulphone|PS-8410|KS-00003R99|Benzenamine,2-fluoro-5-(methylsulfonyl)-|C-5980|2,2-dimethyl-1-phenyl-1-chloropropyl isocyanate|I14-29802|2-AMINO-BETA-L-ARABINOFURANO[1,2:4,5]OXAZOLINE
| Molecular Formula | C7H8FNO2S |
|---|---|
| Molecular Weight | 189.02597 g/mol |
| LogP | 0.8114 |
| Topological Polar Surface Area | 60.16 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 189.02597 |
| Monoisotopic Mass | 189.02597 |
| Heavy Atoms | 12 |
| Complexity | 399.86743 |
Chemical Identifiers
| CAS Number | 355-28-2 |
|---|---|
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)F)N |
Product Overview
2-Fluoro-5-(methylsulfonyl)aniline (CAS 355-28-2), with molecular formula C7H8FNO2S and molecular weight 189.02597 g/mol. IUPAC: 2-fluoro-5-methylsulfonylaniline.
2-Fluoro-5-(methylsulfonyl)aniline is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »