Iodoperfluorocyclohexane
1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-iodocyclohexane
Also Known As: Iodoperfluorocyclohexane|Perfluoroiodocyclohexane|Undecafluoroiodocyclohexane|iodoundecafluorocyclohexane|Perfluorocyclohexyl iodide|1-Iodoundecafluorocyclohexane|undecafluoro(iodo)cyclohexane|Iodoperfluorocyclohexane 100g|1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-iodocyclohexane|4-(pyrrolidin-1-ylcarbonyl)aniline|Undecafluoroiodocyclohexane (stabilized with Copper chip)|1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-iodo-cyclohexane|IODOPERFLUOROCYCLOHEXANE(STABILIZED WITH COPPER CHIP)|Cyclohexane,1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-iodo-
| Molecular Formula | C6F11I |
|---|---|
| Molecular Weight | 407.8869 g/mol |
| LogP | 4.2773 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 0 |
| Exact Mass | 407.8869 |
| Monoisotopic Mass | 407.8869 |
| Heavy Atoms | 18 |
| Complexity | 252.67108 |
Chemical Identifiers
| CAS Number | 355-69-1 |
|---|---|
| SMILES | C1(C(C(C(C(C1(F)F)(F)F)(F)I)(F)F)(F)F)(F)F |
Product Overview
Iodoperfluorocyclohexane (CAS 355-69-1), with molecular formula C6F11I and molecular weight 407.8869 g/mol. IUPAC: 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-iodocyclohexane.