Benzenamine, 3-chloro-N-(4-pyridinylmethylene)-
N-(3-chlorophenyl)-1-pyridin-4-ylmethanimine
Also Known As: CBMicro_019691|Benzenamine, 3-chloro-N-(4-pyridinylmethylene)-|CCG-7688|4-[[(3-Chlorophenyl)imino]methyl]pyridine|4-(3-Chlorophenyliminomethyl)pyridine|N-(3-chlorophenyl)-1-pyridin-4-ylmethanimine|BIM-0019575.P001|3-chloro-N-(pyridin-4-ylmethylidene)aniline|3-Chloro-N-(4-pyridinylmethylene)benzenamine|N-(3-chlorophenyl)-1-(pyridin-4-yl)methanimine|AK-968/11283290|N-(3-chlorophenyl)-N-(4-pyridinylmethylene)amine|3-Chloro-N-[(E)-4-pyridinylmethylidene]aniline #|(E)-N-(3-Chlorophenyl)-1-(pyridin-4-yl)methanimine
| Molecular Formula | C12H9ClN2 |
|---|---|
| Molecular Weight | 216.04543 g/mol |
| LogP | 2.8 |
| Topological Polar Surface Area | 25.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 216.04543 |
| Monoisotopic Mass | 216.04543 |
| Heavy Atoms | 15 |
| Complexity | 212.0 |
Chemical Identifiers
| CAS Number | 35507-55-2 |
|---|---|
| SMILES | C1=CC(=CC(=C1)Cl)N=CC2=CC=NC=C2 |
| InChIKey | GXAZQRDIOPIGHU-UHFFFAOYSA-N |
Product Overview
Benzenamine, 3-chloro-N-(4-pyridinylmethylene)- (CAS 35507-55-2), with molecular formula C12H9ClN2 and molecular weight 216.04543 g/mol. IUPAC: N-(3-chlorophenyl)-1-pyridin-4-ylmethanimine.
Benzenamine, 3-chloro-N-(4-pyridinylmethylene)- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »