Bis(2,4-dimethoxyphenyl)methanone
bis(2,4-dimethoxyphenyl)methanone
Also Known As: bis(2,4-dimethoxyphenyl)methanone|2,2',4,4'-Tetramethoxybenzophenone|CBMicro_021652|2,4-dimethoxyphenyl ketone|Oprea1_419629|Oprea1_754627|di2,4-dimethoxyphenyl ketone|Bis(2,4-dimethoxyphenyl) ketone|CCG-8955|Methanone,bis(2,4-dimethoxyphenyl)-|BAS 00399032|Bis-(2,4-dimethoxy-phenyl)-methanone|2 2'4 4'-Tetramethoxybenzophenone 97|BIM-0021525.P001|2,2 ,4,4 -Tetramethoxybenzophenone|J1.596.077I|2 2' 4 4'-TETRAMETHOXYBENZOPHENONE 97|SR-01000315301-1|I01-17364|2,2 inverted exclamation marka,4,4 inverted exclamation marka-Tetramethoxybenzophenone
| Molecular Formula | C17H18O5 |
|---|---|
| Molecular Weight | 302.11542 g/mol |
| LogP | 2.952 |
| Topological Polar Surface Area | 53.99 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Exact Mass | 302.11542 |
| Monoisotopic Mass | 302.11542 |
| Heavy Atoms | 22 |
| Complexity | 621.2447 |
Chemical Identifiers
| CAS Number | 3555-85-9 |
|---|---|
| SMILES | COC1=CC(=C(C=C1)C(=O)C2=C(C=C(C=C2)OC)OC)OC |
Product Overview
Bis(2,4-dimethoxyphenyl)methanone (CAS 3555-85-9), with molecular formula C17H18O5 and molecular weight 302.11542 g/mol. IUPAC: bis(2,4-dimethoxyphenyl)methanone.