(S)-2-Amino-3-(4-chlorophenyl)propan-1-OL
(2S)-2-amino-3-(4-chlorophenyl)propan-1-ol
Also Known As: dl-p-Chlorophenylalaninol|(S)-2-AMINO-3-(4-CHLOROPHENYL)PROPAN-1-OL|DL-4-Chlorophenylalaninol|(2S)-2-amino-3-(4-chlorophenyl)propan-1-ol|(S)-b-Amino-4-chlorobenzenepropanol|(S)-beta-(4-Chlorophenyl)alaninol|(S)-b-(4-chlorophenyl)alaninol|(R)-b-Amino-4-chlorobenzenepropanol|(S)-2-Amino-3-(4-chlorophenyl)-1-propanol|2-Amino-3-(4-chlorophenyl)-1-propanol|Benzenepropanol, beta-amino-4-chloro-, (betaS)-|(S)-beta-Amino-4-chlorobenzene-1-propanol|(S)-2-Amino-3-(p-chlorophenyl)-1-propanol|Benzenepropanol, ?-amino-4-chloro-, (?S)-|Benzenepropanol, |A-amino-4-chloro-, (|AS)-|(1S)-1-(4-Chlorophenylmethyl)-2-hydroxyethylamine|I01-8307
| Molecular Formula | C9H12ClNO |
|---|---|
| Molecular Weight | 185.06075 g/mol |
| LogP | 1.3 |
| Topological Polar Surface Area | 46.3 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 185.06075 |
| Monoisotopic Mass | 185.06075 |
| Heavy Atoms | 12 |
| Complexity | 124.0 |
Chemical Identifiers
| CAS Number | 35570-85-5 |
|---|---|
| SMILES | C1=CC(=CC=C1C[C@@H](CO)N)Cl |
| InChIKey | RPHQMRWKOPBZQY-VIFPVBQESA-N |
Patent-Derived Application Labels
Derived from 7 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
(S)-2-Amino-3-(4-chlorophenyl)propan-1-OL (CAS 35570-85-5), with molecular formula C9H12ClNO and molecular weight 185.06075 g/mol. IUPAC: (2S)-2-amino-3-(4-chlorophenyl)propan-1-ol.
(S)-2-Amino-3-(4-chlorophenyl)propan-1-OL is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »