N'-[(2E,3E)-4-(furan-2-yl)but-3-en-2-ylidene]-2-hydroxy-2-phenylacetohydrazide
N-[(E)-[(E)-4-(furan-2-yl)but-3-en-2-ylidene]amino]-2-hydroxy-2-phenylacetamide
Also Known As: AG-670/32483009|(E)-N'-((E)-4-(furan-2-yl)but-3-en-2-ylidene)-2-hydroxy-2-phenylacetohydrazide|Hydroxy-phenyl-acetic acid [(E)-3-furan-2-yl-1-methyl-prop-2-en-(E)-ylidene]-hydrazide|N'-[(2E,3E)-4-(furan-2-yl)but-3-en-2-ylidene]-2-hydroxy-2-phenylacetohydrazide|N'-[3-(2-furyl)-1-methyl-2-propenylidene]-2-hydroxy-2-phenylacetohydrazide|N-((1E,3E)-4-(2-furyl)-2-methyl-1-azabuta-1,3-dienyl)-2-hydroxy-2-phenylacetam ide
| Molecular Formula | C16H16N2O3 |
|---|---|
| Molecular Weight | 284.1161 g/mol |
| LogP | 2.5185 |
| Topological Polar Surface Area | 74.83 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 284.1161 |
| Monoisotopic Mass | 284.1161 |
| Heavy Atoms | 21 |
| Complexity | 630.8064 |
Chemical Identifiers
| CAS Number | 355809-29-9 |
|---|---|
| SMILES | C/C(=N\NC(=O)C(C1=CC=CC=C1)O)/C=C/C2=CC=CO2 |
Product Overview
N'-[(2E,3E)-4-(furan-2-yl)but-3-en-2-ylidene]-2-hydroxy-2-phenylacetohydrazide (CAS 355809-29-9), with molecular formula C16H16N2O3 and molecular weight 284.1161 g/mol. IUPAC: N-[(E)-[(E)-4-(furan-2-yl)but-3-en-2-ylidene]amino]-2-hydroxy-2-phenylacetamide.