Acetamide, 2,2-dichloro-N-(2-hydroxyethyl)-N-(p-methylbenzyl)-
2,2-dichloro-N-(2-hydroxyethyl)-N-[(4-methylphenyl)methyl]acetamide
Also Known As: starbld0035781|M & B 5297|Acetamide, 2,2-dichloro-N-(2-hydroxyethyl)-N-(p-methylbenzyl)-|LS-8869|2,2-dichloro-N-(2-hydroxyethyl)-N-[(4-methylphenyl)methyl]acetamide|2,2-Dichloro-N-(2-hydroxyethyl)-N-(p-methylbenzyl)acetamide|2,2-dichloro-N-(2-hydroxyethyl)-N-(4-methylbenzyl)acetamide
| Molecular Formula | C12H15Cl2NO2 |
|---|---|
| Molecular Weight | 275.04797 g/mol |
| LogP | 2.2 |
| Topological Polar Surface Area | 40.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Exact Mass | 275.04797 |
| Monoisotopic Mass | 275.04797 |
| Heavy Atoms | 17 |
| Complexity | 241.0 |
Chemical Identifiers
| CAS Number | 3571-00-4 |
|---|---|
| SMILES | CC1=CC=C(C=C1)CN(CCO)C(=O)C(Cl)Cl |
| InChIKey | LEXACAWUAADPEA-UHFFFAOYSA-N |
Product Overview
Acetamide, 2,2-dichloro-N-(2-hydroxyethyl)-N-(p-methylbenzyl)- (CAS 3571-00-4), with molecular formula C12H15Cl2NO2 and molecular weight 275.04797 g/mol. IUPAC: 2,2-dichloro-N-(2-hydroxyethyl)-N-[(4-methylphenyl)methyl]acetamide.
Acetamide, 2,2-dichloro-N-(2-hydroxyethyl)-N-(p-methylbenzyl)- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »