Methanesulfonamide, N-(4-hydroxyphenyl)-N-methyl-
N-(4-hydroxyphenyl)-N-methylmethanesulfonamide
Also Known As: N-(4-hydroxyphenyl)-N-methylmethanesulfonamide|4'-Hydroxy-N-methylmethanesulfonanilide|M & B 4470|N- -N-methyl-methanesulfonamide|N-(4-hydroxyphenyl)-N-methyl-Methanesulfonamide|Methanesulfonanilide, 4'-hydroxy-N-methyl-|Methanesulfonamide, N-(4-hydroxyphenyl)-N-methyl-|Methanesulfonamide, N-(4-hydroxyphenyl)-N-methyl- (9CI)|(4-hydroxyphenyl)methyl(methylsulfonyl)amine|Methanesulfonamide,N-(4-hydroxyphenyl)-N-methyl-|N-methyl-N-(4-hydroxyphenyl)methanesulfonamide|W-7357|Methanesulfonamide, N-(4-hydroxyphenyl)-N-methyl-(9CI)|960-295-5
| Molecular Formula | C8H11NO3S |
|---|---|
| Molecular Weight | 201.04596 g/mol |
| LogP | 0.7 |
| Topological Polar Surface Area | 66.0 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 201.04596 |
| Monoisotopic Mass | 201.04596 |
| Heavy Atoms | 13 |
| Complexity | 249.0 |
Chemical Identifiers
| CAS Number | 3572-85-8 |
|---|---|
| SMILES | CN(C1=CC=C(C=C1)O)S(=O)(=O)C |
| InChIKey | UTJCBWGFCODDEI-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Methanesulfonamide, N-(4-hydroxyphenyl)-N-methyl- (CAS 3572-85-8), with molecular formula C8H11NO3S and molecular weight 201.04596 g/mol. IUPAC: N-(4-hydroxyphenyl)-N-methylmethanesulfonamide.