[2-(4-Chlorophenyl)-1,3-thiazol-4-yl]methanol
[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methanol
Also Known As: (2-(4-Chlorophenyl)thiazol-4-yl)methanol|Dansylchloride|[2-(4-Chlorophenyl)-1,3-thiazol-4-yl]methanol|[2-(4-Chloro-phenyl)-thiazol-4-yl]-methanol|4-Thiazolemethanol, 2-(4-chlorophenyl)-|2-(4-Chlorophenyl)thiazole-4-methanol|CC-2007|[2- -THIAZOL-4-YL]-METHANOL|2-(p-Chlorphenyl)-4-hydroxymethylthiazol|2-(4-Chlorophenyl)-4-hydroxymethylthiazole|Thiazole-4-methanol, 2-(4-chlorophenyl)-|2-(4'-Chlorophenyl)-4-(hydroxymethyl)thiazole|2-(4-chlorophenyl)-1,3-thiazol-4-ylmethanol|(2-(4-chlorophenyl)-1,3-thiazol-4-yl)methanol|[2-(4-Chlorophenyl)-1,3-thiazol-4-yl]methanol #|887-624-4
| Molecular Formula | C10H8ClNOS |
|---|---|
| Molecular Weight | 225.00151 g/mol |
| LogP | 2.4 |
| Topological Polar Surface Area | 61.4 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 225.00151 |
| Monoisotopic Mass | 225.00151 |
| Heavy Atoms | 14 |
| Complexity | 185.0 |
Chemical Identifiers
| CAS Number | 36093-99-9 |
|---|---|
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)CO)Cl |
| InChIKey | GGAMZEDLVRNGBN-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
[2-(4-Chlorophenyl)-1,3-thiazol-4-yl]methanol (CAS 36093-99-9), with molecular formula C10H8ClNOS and molecular weight 225.00151 g/mol. IUPAC: [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methanol.