2-Methoxyestrone
(8R,9S,13S,14S)-3-hydroxy-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one
Also Known As: 2-METHOXYESTRONE|2-Methoxy Estrone|methoxy-Estrone|Estrone, 2-methoxy-|2-methoxy-estrone|2-Methoxyestrone?|2-Hydroxyestrone 2-methyl ether|2-MeOE1|2-OMeE1|2-MeE1|GSS 33|GSS-33|3-Hydroxy-2-methoxyestra-1,3,5(10)-trien-17-one|EINECS 206-645-6|2-Methoxyestrone, analytical standard|2-Methoxy-17-oxoestra-1,3,5(10)-trien-3-ol|2-Methoxy-3-hydroxyestra-1,3,5(10)-trien-17-one|MSK011002-100A|Estra-1,3,5(10)-trien-17-one,3-hydroxy-2-methoxy-|SID:96099870
| Molecular Formula | C19H24O3 |
|---|---|
| Molecular Weight | 300.17255 g/mol |
| LogP | 3.1 |
| Topological Polar Surface Area | 46.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 300.17255 |
| Monoisotopic Mass | 300.17255 |
| Heavy Atoms | 22 |
| Complexity | 462.0 |
Chemical Identifiers
| CAS Number | 362-08-3 |
|---|---|
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=CC(=C(C=C34)OC)O |
| InChIKey | WHEUWNKSCXYKBU-QPWUGHHJSA-N |
Patent-Derived Application Labels
Derived from 7 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-Methoxyestrone (CAS 362-08-3), with molecular formula C19H24O3 and molecular weight 300.17255 g/mol. IUPAC: (8R,9S,13S,14S)-3-hydroxy-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.