(2-Amino-5-fluorophenyl)(phenyl)methanone
(2-amino-5-fluorophenyl)-phenylmethanone
Also Known As: (2-amino-5-fluorophenyl)(phenyl)methanone|2-AMINO-5-FLUOROBENZOPHENONE|5-fluoro-2-aminobenzophenone|2-benzoyl-4-fluoroaniline|(2-amino-5-fluorophenyl)-phenylmethanone|Oprea1_177078|Oprea1_870245|2-Amino-5-fluoro-benzophenone|(2-amino-5-fluoro-phenyl)-phenyl-methanone|2-amino-5-fluorophenyl phenyl ketone|(2-Amino-5-fluorophenyl)phenyl ketone|(2-Amino-5-fluorophenyl)phenylmethanone|NCGC00323310-01|J3.422.703I|AB00109760-01|AB00109760-03|AG-670/14928005|SR-01000534749-1
| Molecular Formula | C13H10FNO |
|---|---|
| Molecular Weight | 215.07465 g/mol |
| LogP | 3.1 |
| Topological Polar Surface Area | 43.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 215.07465 |
| Monoisotopic Mass | 215.07465 |
| Heavy Atoms | 16 |
| Complexity | 250.0 |
Chemical Identifiers
| CAS Number | 362-46-9 |
|---|---|
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)F)N |
| InChIKey | OTBMFWQZXXWHOO-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
(2-Amino-5-fluorophenyl)(phenyl)methanone (CAS 362-46-9), with molecular formula C13H10FNO and molecular weight 215.07465 g/mol. IUPAC: (2-amino-5-fluorophenyl)-phenylmethanone.