Ethyl 2-(4-chlorobenzyl)acetoacetate
ethyl 2-[(4-chlorophenyl)methyl]-3-oxobutanoate
Also Known As: 2-(4-Chlorobenzyl)acetoacetic acid ethyl ester|ethyl 2-(4-chlorobenzyl)-3-oxobutanoate|ethyl 2-[(4-chlorophenyl)methyl]-3-oxobutanoate|ethyl 2-(4-chlorobenzyl)acetoacetate|1707AE|ethyl 2-(4-chlorobenzyl)-acetoacetate|ethyl2-(4-chlorobenzyl)-3-oxobutanoate|2-(4-chlorobenzyl)acetoacetic ethyl ester|Benzenepropanoic acid, a-acetyl-4-chloro-, ethyl ester|DIETHYLETHYL(1-METHYLPROPYL)MALONATE|ethyl 2-acetyl-3-(4-chlorophenyl)propanoate|1-(ethoxycarbonyl)-1-(p-chlorobenzyl)-2-propanone|2-(4-Chlorobenzyl)-3-oxobutanoic acid ethyl ester|(+/-)-ethyl 2-(4-chlorobenzyl)-3-oxobutanoate|2-(4-chlorobenzyl)-3-oxobutyric acid ethyl ester|ethyl 2-[(4-chlorophenyl)methyl]-3-oxo-butanoate|benzenepropanoic acid, alpha-acetyl-4-chloro-, ethyl ester|671-395-0
| Molecular Formula | C13H15ClO3 |
|---|---|
| Molecular Weight | 254.07097 g/mol |
| LogP | 2.6508 |
| Topological Polar Surface Area | 43.37 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 254.07097 |
| Monoisotopic Mass | 254.07097 |
| Heavy Atoms | 17 |
| Complexity | 397.63052 |
Chemical Identifiers
| CAS Number | 36600-72-3 |
|---|---|
| SMILES | CCOC(=O)C(CC1=CC=C(C=C1)Cl)C(=O)C |
Product Overview
Ethyl 2-(4-chlorobenzyl)acetoacetate (CAS 36600-72-3), with molecular formula C13H15ClO3 and molecular weight 254.07097 g/mol. IUPAC: ethyl 2-[(4-chlorophenyl)methyl]-3-oxobutanoate.