3-[(4-Methylphenyl)amino]cyclohex-2-en-1-one
3-(4-methylanilino)cyclohex-2-en-1-one
Also Known As: 3-[(4-methylphenyl)amino]cyclohex-2-en-1-one|3-(4-methylanilino)cyclohex-2-en-1-one|3-(p-Tolylamino)cyclohex-2-enone|2,6-Pyridinedimethanimine(9CI)|3-p-Tolylamino-cyclohex-2-enone|3-(P-tolylamino)cyclohex-2-en-1-one|2-Cyclohexen-1-one, 3-[(4-methylphenyl)amino]-|3-(4-Methylanilino)-2-cyclohexen-1-one|3-(4-Methylphenyl)aminocyclohex-2-en-1-one|3-(4-Methylphenylamino)-2-cyclohexene-1-one|3-[(4-Methylphenyl)amino]-2-cyclohexen-1-one|3-[(4-methyl-phenyl)amino]cyclohex-2-en-1-one
| Molecular Formula | C13H15NO |
|---|---|
| Molecular Weight | 201.11537 g/mol |
| LogP | 3.04382 |
| Topological Polar Surface Area | 29.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 201.11537 |
| Monoisotopic Mass | 201.11537 |
| Heavy Atoms | 15 |
| Complexity | 389.50192 |
Chemical Identifiers
| CAS Number | 36646-74-9 |
|---|---|
| SMILES | CC1=CC=C(C=C1)NC2=CC(=O)CCC2 |
Product Overview
3-[(4-Methylphenyl)amino]cyclohex-2-en-1-one (CAS 36646-74-9), with molecular formula C13H15NO and molecular weight 201.11537 g/mol. IUPAC: 3-(4-methylanilino)cyclohex-2-en-1-one.
3-[(4-Methylphenyl)amino]cyclohex-2-en-1-one is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »