2-Furyl alpha-hydroxybenzyl ketone
1-(furan-2-yl)-2-hydroxy-2-phenylethanone
Also Known As: 2-furyl|A-hydroxybenzyl ketone|2-Furyl alpha-hydroxybenzyl ketone|2-furyl |A-hydroxybenzyl ketone|1-(furan-2-yl)-2-hydroxy-2-phenylethanone|1-(2-Furyl)-2-hydroxy-2-phenylethanone|2-Phenyl-1-(2-furyl)-2-hydroxyethanone|1-(2-furanyl)-2-hydroxy-2-phenylethanone|1-(furan-2-yl)-2-hydroxy-2-phenylethan-1-one|1-(2-Furyl)-2-hydroxy-2-phenylethanone #|2-hydroxy-2-phenyl-1-(furan-2-yl)-ethanone|J1.397.178A|I14-22154
| Molecular Formula | C12H10O3 |
|---|---|
| Molecular Weight | 202.06299 g/mol |
| LogP | 2.0 |
| Topological Polar Surface Area | 50.4 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 202.06299 |
| Monoisotopic Mass | 202.06299 |
| Heavy Atoms | 15 |
| Complexity | 221.0 |
Chemical Identifiers
| CAS Number | 36715-43-2 |
|---|---|
| SMILES | C1=CC=C(C=C1)C(C(=O)C2=CC=CO2)O |
| InChIKey | OAQXMQGZCPHDDV-UHFFFAOYSA-N |
Product Overview
2-Furyl alpha-hydroxybenzyl ketone (CAS 36715-43-2), with molecular formula C12H10O3 and molecular weight 202.06299 g/mol. IUPAC: 1-(furan-2-yl)-2-hydroxy-2-phenylethanone.
2-Furyl alpha-hydroxybenzyl ketone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »